Difference between revisions of "L-leucyl-L-lysyl-Protein"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ANTHRANILATE 3-HYDROXY-ANTHRANILATE] == * smiles: ** C1(C=C(C(N)=C(O)C=1)C([O-])=O) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-leucyl-L-lysyl-Protein L-leucyl-L-lysyl-Protein] == * common name: ** a [protein] N-terminal...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-leucyl-L-lysyl-Protein L-leucyl-L-lysyl-Protein] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [protein] N-terminal L-leucyl-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-leucyl-L-lysyl-[protein] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LEUCYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [protein] N-terminal L-leucyl-L-lysine}} | |
| − | + | {{#set: common name=L-leucyl-L-lysyl-[protein]}} | |
| − | + | {{#set: produced by=LEUCYLTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite L-leucyl-L-lysyl-Protein
- common name:
- a [protein] N-terminal L-leucyl-L-lysine
- Synonym(s):
- L-leucyl-L-lysyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein] N-terminal L-leucyl-L-lysine" cannot be used as a page name in this wiki.
"L-leucyl-L-lysyl-[protein" cannot be used as a page name in this wiki.
