Difference between revisions of "SIROHYDROCHLORIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TPH TPH] == * direction: ** LEFT-TO-RIGHT * common name: ** Thymidylate 5'-phosphohydrolase * Synon...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TPH TPH] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
 
* common name:
 
* common name:
** Thymidylate 5'-phosphohydrolase
+
** sirohydrochlorin
 +
* inchi key:
 +
** InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
 +
* molecular weight:
 +
** 854.779   
 
* Synonym(s):
 
* Synonym(s):
 +
** Precorrin
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1.0 [[WATER]][c] '''+''' 1.0 [[TMP]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[THYMIDINE]][c]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1.0 H2O[c] '''+''' 1.0 dTMP[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 thymidine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_9166]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[Tiso_gene_6988]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 65207-12-7
{{#set: common name=Thymidylate 5'-phosphohydrolase}}
+
* PUBCHEM:
{{#set: gene associated=Tiso_gene_9166|Tiso_gene_6988}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245154 25245154]
{{#set: in pathway=}}
+
* CHEBI:
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58351 58351]
{{#set: reconstruction tool=pantograph}}
+
* BIGG : scl
{{#set: reconstruction source=creinhardtii}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05778 C05778]
 +
{{#set: smiles=CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))}}
 +
{{#set: common name=sirohydrochlorin}}
 +
{{#set: inchi key=InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F}}
 +
{{#set: molecular weight=854.779    }}
 +
{{#set: common name=Precorrin}}
 +
{{#set: produced by=DIMETHUROPORDEHYDROG-RXN}}

Latest revision as of 20:09, 21 March 2018

Metabolite SIROHYDROCHLORIN

  • smiles:
    • CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
  • common name:
    • sirohydrochlorin
  • inchi key:
    • InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
  • molecular weight:
    • 854.779
  • Synonym(s):
    • Precorrin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))" cannot be used as a page name in this wiki.