Difference between revisions of "1.3.1.9-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.9-RXN 1.3.1.9-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.1.9-RXN 1.3.1.9-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[ACYL-ACP]][c] '''<=>''' 1 [[TRANS-D2-ENOYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NAD+[c] '''+''' 1 an acyl-[acyl-carrier protein][c] '''<=>''' 1 a trans-2-enoyl-[acyl-carrier protein][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10778]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01403 R01403] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-1.3.1.9}} | |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_10778}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Contents
Reaction 1.3.1.9-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 ACYL-ACP[c] <=> 1 TRANS-D2-ENOYL-ACP[c] + 1 PROTON[c] + 1 NADH[c]
- With common name(s):
- 1 NAD+[c] + 1 an acyl-[acyl-carrier protein][c] <=> 1 a trans-2-enoyl-[acyl-carrier protein][c] + 1 H+[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10778
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: