Difference between revisions of "RXN-14382"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == * smiles: ** CSCCC(N[CH]=O)C(=O)[O-] * inchi key: **...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] == * direction: ** LEFT-TO-RIGHT * common name: ** cysteine_mitochondrial ** c...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14382 RXN-14382] ==
−
* smiles:
+
* direction:
−
** CSCCC(N[CH]=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
−
** N-formyl-L-methionine
+
** cysteine_mitochondrial
−
* molecular weight:
+
** cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
−
** 176.21   
+
 
* Synonym(s):
 
* Synonym(s):
−
** fMet
 
−
** N-formyl-methionine
 
−
** formylmethionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[FORMYLMETHIONINE-DEFORMYLASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''+''' 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''=>''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a ThiI sulfur-carrier protein[c] '''+''' 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''=>''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14710]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11478]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4284]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 4289-98-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB04464
+
{{#set: common name=cysteine_mitochondrial}}
−
* PUBCHEM:
+
{{#set: common name=cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288223 5288223]
+
{{#set: gene associated=Tiso_gene_14710|Tiso_gene_11478|Tiso_gene_4284}}
−
* HMDB : HMDB01015
+
{{#set: in pathway=PWY-6892}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03145 C03145]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57809 57809]
+
−
{{#set: smiles=CSCCC(N[CH]=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M}}
+
−
{{#set: common name=N-formyl-L-methionine}}
+
−
{{#set: molecular weight=176.21    }}
+
−
{{#set: common name=fMet|N-formyl-methionine|formylmethionine}}
+
−
{{#set: consumed by=FORMYLMETHIONINE-DEFORMYLASE-RXN}}
+

Latest revision as of 20:09, 21 March 2018

Reaction RXN-14382

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cysteine_mitochondrial
    • cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6892, thiazole biosynthesis I (facultative anaerobic bacteria): PWY-6892
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14382&oldid=46440"