Difference between revisions of "RXN0-6513"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6513 RXN0-6513] == * direction: ** REVERSIBLE * common name: ** 2,3-dehydroadipyl-CoA hydratas...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6513 RXN0-6513] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 2,3-dehydroadipyl-CoA hydratase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[3-HYDROXYADIPYL-COA]][c] '''<=>''' 1.0 [[CPD0-2365]][c] '''+''' 1.0 [[WATER]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1.0 (3S)-hydroxyadipyl-CoA[c] '''<=>''' 1.0 2,3-didehydroadipyl-CoA[c] '''+''' 1.0 H2O[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_6885]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_14262]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_16145]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=2,3-dehydroadipyl-CoA hydratase}} | |
| − | + | {{#set: gene associated=Tiso_gene_6885|Tiso_gene_14262|Tiso_gene_16145}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:09, 21 March 2018
Contents
Reaction RXN0-6513
- direction:
- REVERSIBLE
- common name:
- 2,3-dehydroadipyl-CoA hydratase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 3-HYDROXYADIPYL-COA[c] <=> 1.0 CPD0-2365[c] + 1.0 WATER[c]
- With common name(s):
- 1.0 (3S)-hydroxyadipyl-CoA[c] <=> 1.0 2,3-didehydroadipyl-CoA[c] + 1.0 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6885
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14262
- Source: orthology-esiliculosus
- Gene: Tiso_gene_16145
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
