Difference between revisions of "Tiso gene 10459"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * smiles: ** CC(=O)NCCC2(=CNC1(=C(C=C(O)C=C1)2)) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_10459 == * right end position: ** 7813 * transcription direction: ** NEGATIVE * left end position: ** 4527 * centisome position: ** 53.0901...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10459 == |
− | * | + | * right end position: |
− | ** | + | ** 7813 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 4527 |
− | * | + | * centisome position: |
− | ** | + | ** 53.090183 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * Reaction: [[3.5.1.98-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=7813}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=4527}} | |
− | + | {{#set: centisome position=53.090183 }} | |
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:10, 21 March 2018
Gene Tiso_gene_10459
- right end position:
- 7813
- transcription direction:
- NEGATIVE
- left end position:
- 4527
- centisome position:
- 53.090183
- Synonym(s):
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation