Difference between revisions of "SINAPATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADCPT ADCPT] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dephospho-CoA 3'-phosphotransfe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * common name: ** sinap...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADCPT ADCPT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
 
* common name:
 
* common name:
−
** ATP:dephospho-CoA 3'-phosphotransferase
+
** sinapate
 +
* inchi key:
 +
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
 +
* molecular weight:
 +
** 223.205   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,5-dimethoxy-4-hydroxycinnamate
 +
** sinapinate
 +
** sinapinic acid
 +
** sinapic acid
 +
** 3,5-dimethoxy-4-hydroxycinnamic acid
 +
** 4-hydroxy-3,5-dimethoxycinnamate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10919]]
−
** 1.0 [[DEPHOSPHO-COA]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-3422]]
−
** 1.0 3'-dephospho-CoA[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 ADP[c] '''+''' 1.0 coenzyme A[c]
+
* [[RXN-8014]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19719]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_11263]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:dephospho-CoA 3'-phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
−
{{#set: gene associated=Tiso_gene_19719|Tiso_gene_11263}}
+
* CAS : 530-59-6
−
{{#set: in pathway=}}
+
* NCI:
−
{{#set: reconstruction category=orthology}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB32616
−
{{#set: reconstruction source=creinhardtii}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
 +
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
 +
{{#set: common name=sinapate}}
 +
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
 +
{{#set: molecular weight=223.205    }}
 +
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
 +
{{#set: consumed by=RXN-10919}}
 +
{{#set: produced by=RXN-3422|RXN-8014}}

Latest revision as of 21:10, 21 March 2018

Metabolite SINAPATE

  • smiles:
    • COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
  • common name:
    • sinapate
  • inchi key:
    • InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
  • molecular weight:
    • 223.205
  • Synonym(s):
    • 3,5-dimethoxy-4-hydroxycinnamate
    • sinapinate
    • sinapinic acid
    • sinapic acid
    • 3,5-dimethoxy-4-hydroxycinnamic acid
    • 4-hydroxy-3,5-dimethoxycinnamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SINAPATE&oldid=46509"