Difference between revisions of "CPD-15104"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * inchi key: ** InChIKey=YJVOWRAWF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * common name: ** (R)-3-hydroxy-3-...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC(O)(C)C(=O)C(=O)[O-] | ** CCC(O)(C)C(=O)C(=O)[O-] | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** (R)-3-hydroxy-3-methyl-2-oxopentanoate | ** (R)-3-hydroxy-3-methyl-2-oxopentanoate | ||
| + | * inchi key: | ||
| + | ** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M | ||
* molecular weight: | * molecular weight: | ||
** 145.135 | ** 145.135 | ||
| Line 24: | Line 24: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463] | ** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463] | ||
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}} | {{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}} | ||
| − | |||
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}} | {{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}} | ||
| + | {{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}} | ||
{{#set: molecular weight=145.135 }} | {{#set: molecular weight=145.135 }} | ||
{{#set: consumed by=R05068}} | {{#set: consumed by=R05068}} | ||
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-14106}} |
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite CPD-15104
- smiles:
- CCC(O)(C)C(=O)C(=O)[O-]
- common name:
- (R)-3-hydroxy-3-methyl-2-oxopentanoate
- inchi key:
- InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
- molecular weight:
- 145.135
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.
