Difference between revisions of "Tiso gene 14208"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14208 == * Synonym(s): == Reactions associated == * Reaction: 3.4.21.89-RXN ** Source: orthology-esiliculosus * Reaction: RXN0-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
+
== Gene Tiso_gene_14208 ==
* smiles:
+
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
* inchi key:
+
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
+
* common name:
+
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
+
* molecular weight:
+
** 353.228   
+
 
* Synonym(s):
 
* Synonym(s):
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10058]]
+
* Reaction: [[3.4.21.89-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN0-3201]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.4.21.89-RXN|RXN0-3201}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
+
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
+
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
+
{{#set: molecular weight=353.228    }}
+
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
+
{{#set: consumed by=RXN-10058}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_14208

  • Synonym(s):

Reactions associated

Pathways associated

External links