Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDROQUINATE-DEHYDRATASE-RXN 3-DEHYDROQUINATE-DEHYDRATASE-RXN] == * direction: ** REVERSIBLE *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDROQUINATE-DEHYDRATASE-RXN 3-DEHYDROQUINATE-DEHYDRATASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pentafunctional_protein |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.10 EC-4.2.1.10] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[DEHYDROQUINATE]][c] '''<=>''' 1 [[3-DEHYDRO-SHIKIMATE]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 3-dehydroquinate[c] '''<=>''' 1 3-dehydroshikimate[c] '''+''' 1 H2O[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14718]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5752]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5753]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5619]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8720]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6707]], gallate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6416]], quinate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[QUINATEDEG-PWY]], quinate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=QUINATEDEG-PWY QUINATEDEG-PWY] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21096 21096] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03084 R03084] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P05195 P05195] |
− | * | + | ** [http://www.uniprot.org/uniprot/P46380 P46380] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9CF39 Q9CF39] |
− | * | + | ** [http://www.uniprot.org/uniprot/P07547 P07547] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P08566 P08566] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43878 P43878] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P05194 P05194] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58849 Q58849] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A4Z6 P0A4Z6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PJ53 Q9PJ53] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P05147 P05147] |
+ | ** [http://www.uniprot.org/uniprot/P24670 P24670] | ||
+ | ** [http://www.uniprot.org/uniprot/P35146 P35146] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42947 Q42947] | ||
+ | ** [http://www.uniprot.org/uniprot/Q48255 Q48255] | ||
+ | ** [http://www.uniprot.org/uniprot/P73367 P73367] | ||
+ | ** [http://www.uniprot.org/uniprot/O65917 O65917] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=pentafunctional_protein}} | ||
+ | {{#set: ec number=EC-4.2.1.10}} | ||
+ | {{#set: gene associated=Tiso_gene_14718|Tiso_gene_5752|Tiso_gene_5753|Tiso_gene_5619|Tiso_gene_8720}} | ||
+ | {{#set: in pathway=PWY-6707|PWY-6416|QUINATEDEG-PWY|PWY-6163}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation|manual-primary_network|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 21:10, 21 March 2018
Contents
Reaction 3-DEHYDROQUINATE-DEHYDRATASE-RXN
- direction:
- REVERSIBLE
- common name:
- pentafunctional_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DEHYDROQUINATE[c] <=> 1 3-DEHYDRO-SHIKIMATE[c] + 1 WATER[c]
- With common name(s):
- 1 3-dehydroquinate[c] <=> 1 3-dehydroshikimate[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14718
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5752
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5753
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5619
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8720
- Source: orthology-athaliana
- Source: orthology-esiliculosus
Pathways
- PWY-6707, gallate biosynthesis: PWY-6707
- 1 reactions found over 3 reactions in the full pathway
- PWY-6416, quinate degradation II: PWY-6416
- 2 reactions found over 3 reactions in the full pathway
- QUINATEDEG-PWY, quinate degradation I: QUINATEDEG-PWY
- 1 reactions found over 3 reactions in the full pathway
- PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: