Difference between revisions of "Tiso gene 17377"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17377 == * right end position: ** 3495 * transcription direction: ** NEGATIVE * left end position: ** 1 * centisome position: ** 2.67379700...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Gene Tiso_gene_17377 ==
−
* smiles:
+
* right end position:
−
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
+
** 3495
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** paraoxon
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 275.197   
+
** 2.67379700e-2
 
* Synonym(s):
 
* Synonym(s):
−
** O,O-diethyl-O-p-nitrophenylphosphoric acid
 
−
** diethyl-p-nitrophenyl phosphate
 
−
** phosphoric acid diethyl 4-nitrophenyl ester
 
−
** diethyl paraoxon
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8746]]
+
* Reaction: [[3.5.1.98-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 311-45-5
+
{{#set: right end position=3495}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395]
+
{{#set: left end position=1}}
−
* HMDB : HMDB13035
+
{{#set: centisome position=2.67379700e-2}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.5.1.98-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}}
+
−
{{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraoxon}}
+
−
{{#set: molecular weight=275.197    }}
+
−
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}}
+
−
{{#set: consumed by=RXN-8746}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_17377

  • right end position:
    • 3495
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1
  • centisome position:
    • 2.67379700e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17377&oldid=46595"