Difference between revisions of "HOP-2229-ENE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10395 == * Synonym(s): == Reactions associated == * GLUTDECARBOX-RXN ** pantograph-creinhardtii * LYSDECARBOX-RXN ** pan...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == * smiles: ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCC...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == |
+ | * smiles: | ||
+ | ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5)) | ||
+ | * common name: | ||
+ | ** hop-22(29)-ene | ||
+ | * inchi key: | ||
+ | ** InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N | ||
+ | * molecular weight: | ||
+ | ** 410.725 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** diploptene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[5.4.99.17-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92155 92155] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.83200.html 83200] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4648 4648] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06310 C06310] | ||
+ | {{#set: smiles=C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))}} | ||
+ | {{#set: common name=hop-22(29)-ene}} | ||
+ | {{#set: inchi key=InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N}} | ||
+ | {{#set: molecular weight=410.725 }} | ||
+ | {{#set: common name=diploptene}} | ||
+ | {{#set: produced by=5.4.99.17-RXN}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite HOP-2229-ENE
- smiles:
- C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))
- common name:
- hop-22(29)-ene
- inchi key:
- InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N
- molecular weight:
- 410.725
- Synonym(s):
- diploptene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))" cannot be used as a page name in this wiki.