Difference between revisions of "CPD-703"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == * smiles: ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenz...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-nitrobenzaldehyde |
| + | * inchi key: | ||
| + | ** InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 151.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4NBZ |
| + | ** p-nitrobenzaldehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5141]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 555-16-8 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=541 541] |
| − | * | + | * CHEMSPIDER: |
| − | {{#set: smiles=C(O) | + | ** [http://www.chemspider.com/Chemical-Structure.526.html 526] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66926 66926] |
| − | {{#set: molecular weight= | + | * NCI: |
| − | {{#set: common name= | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6103 6103] |
| − | {{#set: consumed by= | + | {{#set: smiles=C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)}} |
| + | {{#set: common name=4-nitrobenzaldehyde}} | ||
| + | {{#set: inchi key=InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=151.121 }} | ||
| + | {{#set: common name=4NBZ|p-nitrobenzaldehyde}} | ||
| + | {{#set: consumed by=RXN0-5141}} | ||
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-703
- smiles:
- C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)
- common name:
- 4-nitrobenzaldehyde
- inchi key:
- InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N
- molecular weight:
- 151.121
- Synonym(s):
- 4NBZ
- p-nitrobenzaldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
