Difference between revisions of "RXNQT-4178"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == * smiles: ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=BXRF...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4178 RXNQT-4178] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydro...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4178 RXNQT-4178] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-isopropylmalate dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[CPDQT-40]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-41]][c] '''+''' 1 [[NADH]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NAD+[c] '''+''' 1 3-(7'-methylthio)heptylmalate[c] '''=>''' 1 CO2[c] '''+''' 1 10-(methylthio)-2-oxodecanoate[c] '''+''' 1 NADH[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2920]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08646 R08646] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-isopropylmalate dehydrogenase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-1.1.1.85}} |
− | + | {{#set: gene associated=Tiso_gene_2920}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation}} | |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:11, 21 March 2018
Contents
Reaction RXNQT-4178
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-isopropylmalate dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 CPDQT-40[c] => 1 CARBON-DIOXIDE[c] + 1 CPDQT-41[c] + 1 NADH[c]
- With common name(s):
- 1 NAD+[c] + 1 3-(7'-methylthio)heptylmalate[c] => 1 CO2[c] + 1 10-(methylthio)-2-oxodecanoate[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2920
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- LIGAND-RXN: