Difference between revisions of "Tiso gene 19348"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_19348 == * right end position: ** 1951 * transcription direction: ** POSITIVE * left end position: ** 173 * centisome position: ** 7.223382...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19348 == |
− | * | + | * right end position: |
− | ** | + | ** 1951 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 173 |
− | * | + | * centisome position: |
− | ** | + | ** 7.223382 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.6.1.41-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | + | == Pathways associated == | |
− | * [[ | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1951}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=173}} | |
− | + | {{#set: centisome position=7.223382 }} | |
− | + | {{#set: reaction associated=3.6.1.41-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:11, 21 March 2018
Gene Tiso_gene_19348
- right end position:
- 1951
- transcription direction:
- POSITIVE
- left end position:
- 173
- centisome position:
- 7.223382
- Synonym(s):
Reactions associated
- Reaction: 3.6.1.41-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation