Difference between revisions of "Tiso gene 9140"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2 LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2] == * smiles: ** C(C6...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9140 == * right end position: ** 8924 * transcription direction: ** POSITIVE * left end position: ** 6694 * centisome position: ** 69.94775...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2 LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2] ==
+
== Gene Tiso_gene_9140 ==
−
* smiles:
+
* right end position:
−
** C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-]
+
** 8924
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AEYXZGCDWDUIKX-OFFAAIFBSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate
+
** 6694
−
* molecular weight:
+
* centisome position:
−
** 811.593    
+
** 69.947754    
 
* Synonym(s):
 
* Synonym(s):
−
** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide
 
−
** luteolin triglucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15289]]
+
* Reaction: [[RXN-12086]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12579]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRIACYLGLYCEROL-LIPASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[LIPAS-PWY]]
 +
* [[PWY-6857]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8924}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878438 46878438]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6694}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58678 58678]
+
{{#set: centisome position=69.947754   }}
−
* HMDB : HMDB60296
+
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
−
{{#set: smiles=C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-]}}
+
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
−
{{#set: inchi key=InChIKey=AEYXZGCDWDUIKX-OFFAAIFBSA-K}}
+
−
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate}}
+
−
{{#set: molecular weight=811.593   }}
+
−
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide|luteolin triglucuronide}}
+
−
{{#set: consumed by=RXN-15289}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_9140

  • right end position:
    • 8924
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6694
  • centisome position:
    • 69.947754
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9140&oldid=46665"