Difference between revisions of "Tiso gene 3166"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_3166 == * right end position: ** 12141 * transcription direction: ** POSITIVE * left end position: ** 10930 * centisome position: ** 63.015...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3166 == |
− | * | + | * right end position: |
− | ** | + | ** 12141 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10930 |
− | * | + | * centisome position: |
− | ** | + | ** 63.015278 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12141}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10930}} | |
− | + | {{#set: centisome position=63.015278 }} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:11, 21 March 2018
Gene Tiso_gene_3166
- right end position:
- 12141
- transcription direction:
- POSITIVE
- left end position:
- 10930
- centisome position:
- 63.015278
- Synonym(s):
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation