Difference between revisions of "Tiso gene 12375"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12375 == * right end position: ** 7021 * transcription direction: ** NEGATIVE * left end position: ** 1881 * centisome position: ** 26.5004...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] ==
+
== Gene Tiso_gene_12375 ==
−
* smiles:
+
* right end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 7021
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** phytanoyl-CoA
+
** 1881
−
* molecular weight:
+
* centisome position:
−
** 1058.022    
+
** 26.500422    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.11.18-RXN]]
+
* Reaction: [[3.1.1.23-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN66-482]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15088]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15089]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[LIPAS-PWY]]
 +
* [[PWY-7420]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7021}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658363 90658363]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=1881}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15538 15538]
+
{{#set: centisome position=26.500422   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.1.23-RXN|LYSOPHOSPHOLIPASE-RXN|RXN-15035|RXN-15088|RXN-15089}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02060 C02060]
+
{{#set: pathway associated=PWY-7409|LIPAS-PWY|PWY-7420}}
−
* HMDB : HMDB01359
+
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
−
{{#set: inchi key=InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J}}
+
−
{{#set: common name=phytanoyl-CoA}}
+
−
{{#set: molecular weight=1058.022   }}
+
−
{{#set: consumed by=1.14.11.18-RXN}}
+
−
{{#set: produced by=RXN66-482}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_12375

  • right end position:
    • 7021
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1881
  • centisome position:
    • 26.500422
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12375&oldid=46698"