Difference between revisions of "CPD-7025"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4015 == * Synonym(s): == Reactions associated == * NODOx ** pantograph-creinhardtii * NODOy ** pantograph-creinhardt...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == |
+ | * smiles: | ||
+ | ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C | ||
+ | * common name: | ||
+ | ** phytyl monophosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L | ||
+ | * molecular weight: | ||
+ | ** 374.499 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** phytolmonophosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7683]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] | ||
+ | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} | ||
+ | {{#set: common name=phytyl monophosphate}} | ||
+ | {{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}} | ||
+ | {{#set: molecular weight=374.499 }} | ||
+ | {{#set: common name=phytolmonophosphate}} | ||
+ | {{#set: produced by=RXN-7683}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-7025
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
- common name:
- phytyl monophosphate
- inchi key:
- InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
- molecular weight:
- 374.499
- Synonym(s):
- phytolmonophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.