Difference between revisions of "RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48."

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48. RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48. RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.] ==
−
* smiles:
+
* direction:
−
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
+
−
* common name:
+
−
** indoxyl sulfate
+
−
* molecular weight:
+
−
** 212.2   
+
 
* Synonym(s):
 
* Synonym(s):
−
** indol-3-yl sulfate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[CO-A]][c] '''+''' 1.0 [[R-2-HYDROXYSTEARATE]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[CPD-14717]][c] '''+''' 1.0 [[AMP]][c]
−
* [[RXN-15587]]
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 coenzyme A[c] '''+''' 1.0 (R)-2-hydroxystearate[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 (R)-2-hydroxy-stearoyl-CoA[c] '''+''' 1.0 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=gap-filling}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
* HMDB : HMDB00682
+
{{#set: reconstruction tool=meneco}}
−
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
+
{{#set: reconstruction comment=added for gapfilling}}
−
{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
+
−
{{#set: common name=indoxyl sulfate}}
+
−
{{#set: molecular weight=212.2    }}
+
−
{{#set: common name=indol-3-yl sulfate}}
+
−
{{#set: consumed or produced by=RXN-15587}}
+

Latest revision as of 20:11, 21 March 2018

Reaction RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 coenzyme A[c] + 1.0 (R)-2-hydroxystearate[c] => 1.0 diphosphate[c] + 1.0 (R)-2-hydroxy-stearoyl-CoA[c] + 1.0 AMP[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.&oldid=46721"