Difference between revisions of "RXN-10952"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-881 CPD-881] == * smiles: ** CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10952 RXN-10952] == * direction: ** LEFT-TO-RIGHT * common name: ** myo-inositol-1(or_4)-monoph...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10952 RXN-10952] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** myo-inositol-1(or_4)-monophosphatase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[D-MYO-INOSITOL-4-PHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c] |
− | == | + | * With common name(s): |
+ | ** 1 1D-myo-inositol 4-monophosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11614]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_2527]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_14713]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6363]], D-myo-inositol (1,4,5)-trisphosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6363 PWY-6363] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30738 30738] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01186 R01186] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=myo-inositol-1(or_4)-monophosphatase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-3.1.3.25}} |
− | + | {{#set: gene associated=Tiso_gene_11614|Tiso_gene_2527|Tiso_gene_14713}} | |
− | + | {{#set: in pathway=PWY-6363}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction RXN-10952
- direction:
- LEFT-TO-RIGHT
- common name:
- myo-inositol-1(or_4)-monophosphatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 D-MYO-INOSITOL-4-PHOSPHATE[c] + 1 WATER[c] => 1 Pi[c] + 1 MYO-INOSITOL[c]
- With common name(s):
- 1 1D-myo-inositol 4-monophosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 myo-inositol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11614
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Gene: Tiso_gene_2527
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14713
- Source: orthology-creinhardtii
Pathways
- PWY-6363, D-myo-inositol (1,4,5)-trisphosphate degradation: PWY-6363
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links