Difference between revisions of "RXN-10919"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10919 RXN-10919] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10919 RXN-10919] ==
* smiles:
+
* direction:
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
+
** [http://enzyme.expasy.org/EC/6.2.1.12 EC-6.2.1.12]
* common name:
+
** β-D-ribose 5-phosphate
+
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-ribofuranose 5-phosphate
 
** 5-O-phosphono-β-D-ribofuranose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15346]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[SINAPATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[SINAPOYL-COA]][c]
* [[RXN-15345]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 sinapate[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 sinapoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14183]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12275]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02221 R02221]
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
+
{{#set: ec number=EC-6.2.1.12}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14183|Tiso_gene_12275}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
+
{{#set: in pathway=}}
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
{{#set: common name=β-D-ribose 5-phosphate}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=228.095    }}
+
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
+
{{#set: consumed by=RXN-15346}}
+
{{#set: produced by=RXN-15345}}
+

Latest revision as of 20:12, 21 March 2018

Reaction RXN-10919

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sinapate[c] + 1 ATP[c] + 1 coenzyme A[c] => 1 AMP[c] + 1 diphosphate[c] + 1 sinapoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links