Difference between revisions of "RXN-15091"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * inchi key: ** InChIKey=HCJMNOSI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15091 RXN-15091] == * direction: ** LEFT-TO-RIGHT * common name: ** diacylglycerol kinase * ec...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15091 RXN-15091] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** diacylglycerol kinase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.174 EC-2.7.1.174] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [ | + | ** 1 [[CTP]][c] '''+''' 1 [[CPD0-1812]][c] '''=>''' 1 [[CDP]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 CTP[c] '''+''' 1 2-oleoylglycerol[c] '''=>''' 1 CDP[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7420]], monoacylglycerol metabolism (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7420 PWY-7420] | ||
| + | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=diacylglycerol kinase}} | |
| − | + | {{#set: ec number=EC-2.7.1.174}} | |
| − | + | {{#set: in pathway=PWY-7420}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction RXN-15091
- direction:
- LEFT-TO-RIGHT
- common name:
- diacylglycerol kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CTP[c] + 1 CPD0-1812[c] => 1 CDP[c] + 1 L-1-LYSOPHOSPHATIDATE[c] + 1 PROTON[c]
- With common name(s):
- 1 CTP[c] + 1 2-oleoylglycerol[c] => 1 CDP[c] + 1 1-oleyl-2-lyso-phosphatidate[c] + 1 H+[c]
Genes associated with this reaction
Pathways
- PWY-7420, monoacylglycerol metabolism (yeast): PWY-7420
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
