Difference between revisions of "CPD1F-120"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1497 == * Synonym(s): == Reactions associated == * 1.14.19.1-RXN ** pantograph-creinhardtii * CY_focytb5_c ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == |
+ | * smiles: | ||
+ | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) | ||
+ | * common name: | ||
+ | ** gibberellin A24 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L | ||
+ | * molecular weight: | ||
+ | ** 344.407 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA24 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN1F-163]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232] |
+ | * HMDB : HMDB37103 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861] | ||
+ | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
+ | {{#set: common name=gibberellin A24}} | ||
+ | {{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}} | ||
+ | {{#set: molecular weight=344.407 }} | ||
+ | {{#set: common name=GA24}} | ||
+ | {{#set: produced by=RXN1F-163}} |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD1F-120
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- common name:
- gibberellin A24
- inchi key:
- InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
- molecular weight:
- 344.407
- Synonym(s):
- GA24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.