Difference between revisions of "DCTUP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * smiles: ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** dCTP:uridine 5'-phosphotransferase...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTUP DCTUP] ==
* smiles:
+
* direction:
** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J
+
 
* common name:
 
* common name:
** 3-oxodecanoyl-CoA
+
** dCTP:uridine 5'-phosphotransferase
* molecular weight:
+
** 931.738   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13617]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DCTP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c] '''+''' 1.0 [[DCDP]][c]
* [[RXN-12490]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 dCTP[c] '''+''' 1.0 uridine[c] '''=>''' 1.0 H+[c] '''+''' 1.0 UMP[c] '''+''' 1.0 dCDP[c]
* [[ACACT4]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* BIGG : 3odcoa
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=dCTP:uridine 5'-phosphotransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262297 53262297]
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
* HMDB : HMDB03939
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C05265 C05265]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62548 62548]
+
* METABOLIGHTS : MTBLC28528
+
{{#set: smiles=CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J}}
+
{{#set: common name=3-oxodecanoyl-CoA}}
+
{{#set: molecular weight=931.738    }}
+
{{#set: consumed by=RXN-13617}}
+
{{#set: produced by=RXN-12490}}
+
{{#set: consumed or produced by=ACACT4}}
+

Latest revision as of 20:12, 21 March 2018

Reaction DCTUP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dCTP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dCTP[c] + 1.0 uridine[c] => 1.0 H+[c] + 1.0 UMP[c] + 1.0 dCDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links