Difference between revisions of "Tiso gene 10824"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
(Created page with "Category:Gene == Gene Tiso_gene_10824 == * right end position: ** 3207 * transcription direction: ** POSITIVE * left end position: ** 2526 * centisome position: ** 30.5626...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10824 == |
− | * | + | * right end position: |
− | ** | + | ** 3207 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2526 |
− | * | + | * centisome position: |
− | ** | + | ** 30.562613 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * | + | == Pathways associated == |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3207}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2526}} | |
− | + | {{#set: centisome position=30.562613 }} | |
− | + | {{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_10824
- right end position:
- 3207
- transcription direction:
- POSITIVE
- left end position:
- 2526
- centisome position:
- 30.562613
- Synonym(s):
Reactions associated
- Reaction: ADENOSINETRIPHOSPHATASE-RXN
- Source: orthology-esiliculosus
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation