Difference between revisions of "Tiso gene 9234"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9234 == * right end position: ** 7990 * transcription direction: ** POSITIVE * left end position: ** 1233 * centisome position: ** 12.98851...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] ==
+
== Gene Tiso_gene_9234 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
+
** 7990
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5α-cholesta-7,24-dien-3β-ol
+
** 1233
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 12.988518    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-26]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7990}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=1233}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290]
+
{{#set: centisome position=12.988518    }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* HMDB : HMDB06842
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}}
+
−
{{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}}
+
−
{{#set: common name=5α-cholesta-7,24-dien-3β-ol}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: consumed by=RXN66-26}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_9234

  • right end position:
    • 7990
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1233
  • centisome position:
    • 12.988518
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9234&oldid=46872"