Difference between revisions of "GLC-6-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLARSINATE DIMETHYLARSINATE] == * smiles: ** C[As](C)(=O)[O-] * inchi key: ** InChIKey=OG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * common name: ** &bet...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-glucose 6-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-glucose-6-P |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[G6PBDHh]] | ||
+ | * [[RXN66-579]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PGIB]] | ||
+ | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
+ | * [[G6PI]] | ||
+ | * [[G6PB_pi_th]] | ||
+ | * [[PGIBh]] | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] |
− | * HMDB : | + | * HMDB : HMDB03498 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] |
− | {{#set: smiles=C | + | * BIGG : g6p |
− | {{#set: | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} |
− | {{#set: | + | {{#set: common name=β-D-glucose 6-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: | + | {{#set: common name=β-D-glucose-6-P}} |
+ | {{#set: consumed by=G6PBDHh|RXN66-579}} | ||
+ | {{#set: reversible reaction associated=PGIB|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|G6PI|G6PB_pi_th|PGIBh}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- common name:
- β-D-glucose 6-phosphate
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- molecular weight:
- 258.121
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.