Difference between revisions of "CPD-15637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2351 CPD0-2351] == * common name: ** a tRNA precursor with a 5' extension and a long 3' tr...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2351 CPD0-2351] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
 +
* smiles:
 +
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** a tRNA precursor with a 5' extension and a long 3' trailer
+
** 6-cis-tridecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
 +
* molecular weight:
 +
** 957.819   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z-tridecenoyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6479]]
+
* [[RXN-14771]]
* [[RXN0-4222]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNA precursor with a 5' extension and a long 3' trailer}}
+
* PUBCHEM:
{{#set: consumed by=RXN0-6479|RXN0-4222}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
 +
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: common name=6-cis-tridecenoyl-CoA}}
 +
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
 +
{{#set: molecular weight=957.819    }}
 +
{{#set: common name=6Z-tridecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14771}}

Latest revision as of 20:13, 21 March 2018

Metabolite CPD-15637

  • smiles:
    • CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 6-cis-tridecenoyl-CoA
  • inchi key:
    • InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
  • molecular weight:
    • 957.819
  • Synonym(s):
    • 6Z-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.