Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-16-BIS-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * inchi key: ** InChIKey=ZNJFBWY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-16-BIS-P N-ACETYL-D-GLUCOSAMINE-16-BIS-P] == * common name: ** N-acetyl-...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-16-BIS-P N-ACETYL-D-GLUCOSAMINE-16-BIS-P] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-D-glucosamine 1,6-bisphosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** N-acetyl-D-glucosamine-1,6-P2 |
− | + | ** N-acetyl-D-glucosamine-1,6-diphosphate | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16426]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16425]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=N-acetyl-D-glucosamine 1,6-bisphosphate}} | |
− | + | {{#set: common name=N-acetyl-D-glucosamine-1,6-P2|N-acetyl-D-glucosamine-1,6-diphosphate}} | |
− | + | {{#set: consumed by=RXN-16426}} | |
− | + | {{#set: produced by=RXN-16425}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: produced by=RXN- | + |
Latest revision as of 21:13, 21 March 2018
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-16-BIS-P
- common name:
- N-acetyl-D-glucosamine 1,6-bisphosphate
- Synonym(s):
- N-acetyl-D-glucosamine-1,6-P2
- N-acetyl-D-glucosamine-1,6-diphosphate