Difference between revisions of "CPD-731"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13754 == * Synonym(s): == Reactions associated == * GLUTAMINESYN-RXN ** in-silico_annotation ***ec-number ** experimental_annotation *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * common name: ** (+)-7-iso-jasm...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == |
| + | * smiles: | ||
| + | ** CCC=CCC1(C(=O)CCC1CC([O-])=O) | ||
| + | * common name: | ||
| + | ** (+)-7-iso-jasmonate | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M | ||
| + | * molecular weight: | ||
| + | ** 209.264 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (+)-7-iso-jasmonic acid | ||
| + | ** iso-jasmonic acid | ||
| + | ** (3R,7S)-(+)-7-iso-jasmonate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10708]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMFA02020003 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18435 18435] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317] | ||
| + | {{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}} | ||
| + | {{#set: common name=(+)-7-iso-jasmonate}} | ||
| + | {{#set: inchi key=InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M}} | ||
| + | {{#set: molecular weight=209.264 }} | ||
| + | {{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate}} | ||
| + | {{#set: produced by=RXN-10708}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-731
- smiles:
- CCC=CCC1(C(=O)CCC1CC([O-])=O)
- common name:
- (+)-7-iso-jasmonate
- inchi key:
- InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
- molecular weight:
- 209.264
- Synonym(s):
- (+)-7-iso-jasmonic acid
- iso-jasmonic acid
- (3R,7S)-(+)-7-iso-jasmonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(=O)CCC1CC([O-])=O)" cannot be used as a page name in this wiki.
