Difference between revisions of "FACOAE1839Z12Z15Z"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FACOAE1839Z12Z15Z FACOAE1839Z12Z15Z] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-Linol...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FACOAE1839Z12Z15Z FACOAE1839Z12Z15Z] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** alpha-Linolenoyl-CoA hydrolase (18:3(9Z,12Z,15Z)) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[LINOLENOYL-COA]][c] '''=>''' 1.0 [[CO-A]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[LINOLENIC_ACID]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 H2O[c] '''+''' 1.0 α-linolenoyl-CoA[c] '''=>''' 1.0 coenzyme A[c] '''+''' 1.0 H+[c] '''+''' 1.0 α-linolenate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_801]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=alpha-Linolenoyl-CoA hydrolase (18:3(9Z,12Z,15Z))}} | |
− | + | {{#set: gene associated=Tiso_gene_801}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:13, 21 March 2018
Contents
Reaction FACOAE1839Z12Z15Z
- direction:
- LEFT-TO-RIGHT
- common name:
- alpha-Linolenoyl-CoA hydrolase (18:3(9Z,12Z,15Z))
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 LINOLENOYL-COA[c] => 1.0 CO-A[c] + 1.0 PROTON[c] + 1.0 LINOLENIC_ACID[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 α-linolenoyl-CoA[c] => 1.0 coenzyme A[c] + 1.0 H+[c] + 1.0 α-linolenate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_801
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii