Difference between revisions of "2-METHYL-3-HYDROXY-BUTYRYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=VALINE--TRNA-LIGASE-RXN VALINE--TRNA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O |
* common name: | * common name: | ||
− | ** | + | ** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J |
+ | * molecular weight: | ||
+ | ** 863.619 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-methyl-3-hydroxybutyryl-CoA | ||
+ | ** (2S,3S)-3-hydroxy-2-methylbutyryl-CoA | ||
+ | ** (S)-3-hydroxy-2-methylbutyryl-CoA | ||
+ | ** 3-hydroxy-2-methylbutyryl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[TIGLYLCOA-HYDROXY-RXN]] | |
− | + | * [[HMNOS]] | |
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657672 90657672] |
− | * | + | * HMDB : HMDB01356 |
− | * | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15449 15449] | |
− | ** [http://www. | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04405 C04405] | |
− | + | {{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O}} | |
− | * | + | {{#set: common name=(2S,3S)-3-hydroxy-2-methylbutanoyl-CoA}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J}} |
− | + | {{#set: molecular weight=863.619 }} | |
− | + | {{#set: common name=2-methyl-3-hydroxybutyryl-CoA|(2S,3S)-3-hydroxy-2-methylbutyryl-CoA|(S)-3-hydroxy-2-methylbutyryl-CoA|3-hydroxy-2-methylbutyryl-CoA}} | |
− | + | {{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|HMNOS}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA
- smiles:
- CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O
- common name:
- (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA
- inchi key:
- InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J
- molecular weight:
- 863.619
- Synonym(s):
- 2-methyl-3-hydroxybutyryl-CoA
- (2S,3S)-3-hydroxy-2-methylbutyryl-CoA
- (S)-3-hydroxy-2-methylbutyryl-CoA
- 3-hydroxy-2-methylbutyryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O" cannot be used as a page name in this wiki.