Difference between revisions of "CPDQT-30"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1474 == * left end position: ** 16245 * transcription direction: ** POSITIVE * right end position: ** 18700 * centisome position: ** 68.521...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * common name: ** 9-(methylthio)-2-o...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCCCCC(=O)C([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** 9-(methylthio)-2-oxononanoate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 217.302 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 9-(methylthio)-2-oxononanoic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-18203]] | |
| − | + | * [[RXNQT-4174]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169] |
| − | {{#set: | + | * KNAPSACK : C00007654 |
| − | {{#set: | + | {{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}} |
| − | {{#set: | + | {{#set: common name=9-(methylthio)-2-oxononanoate}} |
| + | {{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=217.302 }} | ||
| + | {{#set: common name=9-(methylthio)-2-oxononanoic acid}} | ||
| + | {{#set: produced by=RXN-18203|RXNQT-4174}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPDQT-30
- smiles:
- CSCCCCCCCC(=O)C([O-])=O
- common name:
- 9-(methylthio)-2-oxononanoate
- inchi key:
- InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
- molecular weight:
- 217.302
- Synonym(s):
- 9-(methylthio)-2-oxononanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007654
"CSCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
