Difference between revisions of "QUEUINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * common na...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** queuine |
| + | * inchi key: | ||
| + | ** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 278.29 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine | ||
| + | ** base Q | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674] |
| − | {{#set: | + | * HMDB : HMDB01495 |
| − | {{#set: | + | {{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}} |
| + | {{#set: common name=queuine}} | ||
| + | {{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}} | ||
| + | {{#set: molecular weight=278.29 }} | ||
| + | {{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}} | ||
| + | {{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}} | ||
Latest revision as of 21:13, 21 March 2018
Contents
Metabolite QUEUINE
- smiles:
- C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
- common name:
- queuine
- inchi key:
- InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
- molecular weight:
- 278.29
- Synonym(s):
- 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
- base Q
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))" cannot be used as a page name in this wiki.
