Difference between revisions of "Cis-delta21-3-hydroxyC40-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] == * common name: ** a cis-delta21...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-hydroxyC40-ACPs cis-delta21-3-hydroxyC40-ACPs] ==
−
* smiles:
+
−
** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
+
−
* inchi key:
+
−
** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
+
 
* common name:
 
* common name:
−
** L-quinate
+
** a cis-delta21-3-hydroxyC40:1-[acp]
−
* molecular weight:
+
−
** 191.16   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-quinic acid
 
−
** (-)-quinate
 
−
** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[QUINATE-5-DEHYDROGENASE-RXN]]
 
−
* [[RXN-7967]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 77-95-2
+
{{#set: common name=a cis-delta21-3-hydroxyC40:1-[acp]}}
−
* PUBCHEM:
+
{{#set: produced by=RXN1G-287}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296]
+
−
{{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}}
+
−
{{#set: common name=L-quinate}}
+
−
{{#set: molecular weight=191.16    }}
+
−
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}}
+
−
{{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite cis-delta21-3-hydroxyC40-ACPs

  • common name:
    • a cis-delta21-3-hydroxyC40:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta21-3-hydroxyC40:1-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta21-3-hydroxyC40-ACPs&oldid=46976"