Difference between revisions of "CPD-19487"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Mannosides Beta-D-Mannosides] == * common name: ** a β-D-mannoside * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-is...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == |
| + | * smiles: | ||
| + | ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-isopropyl-10-(methylthio)-2-oxodecanoate |
| + | * inchi key: | ||
| + | ** InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 274.331 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18201]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-18200]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: consumed by= | + | {{#set: common name=3-isopropyl-10-(methylthio)-2-oxodecanoate}} |
| + | {{#set: inchi key=InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=274.331 }} | ||
| + | {{#set: consumed by=RXN-18201}} | ||
| + | {{#set: reversible reaction associated=RXN-18200}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-19487
- smiles:
- CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-10-(methylthio)-2-oxodecanoate
- inchi key:
- InChIKey=UKHZBTWECWUVPH-UHFFFAOYSA-L
- molecular weight:
- 274.331
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
