Difference between revisions of "Tiso gene 10649"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene Tiso_gene_10649 == * right end position: ** 8387 * transcription direction: ** POSITIVE * left end position: ** 8215 * centisome position: ** 97.9492...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10649 == |
− | * | + | * right end position: |
− | ** | + | ** 8387 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 8215 |
− | * | + | * centisome position: |
− | ** | + | ** 97.9492 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.1.26.3-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=8387}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=8215}} | |
− | + | {{#set: centisome position=97.9492 }} | |
− | + | {{#set: reaction associated=3.1.26.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_10649
- right end position:
- 8387
- transcription direction:
- POSITIVE
- left end position:
- 8215
- centisome position:
- 97.9492
- Synonym(s):
Reactions associated
- Reaction: 3.1.26.3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation