Difference between revisions of "QUINATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3113 == * Synonym(s): == Reactions associated == * NADH-DEHYDROG-A-RXN ** pantograph-esiliculosus * NADHor_2m ** pantogr...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * common name: ** L-quinate...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == |
| + | * smiles: | ||
| + | ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) | ||
| + | * common name: | ||
| + | ** L-quinate | ||
| + | * inchi key: | ||
| + | ** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ||
| + | * molecular weight: | ||
| + | ** 191.16 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (-)-quinic acid | ||
| + | ** (-)-quinate | ||
| + | ** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[QUINATE-5-DEHYDROGENASE-RXN]] |
| − | + | * [[RXN-7967]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 77-95-2 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ||
| + | {{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}} | ||
| + | {{#set: common name=L-quinate}} | ||
| + | {{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} | ||
| + | {{#set: molecular weight=191.16 }} | ||
| + | {{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | ||
| + | {{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite QUINATE
- smiles:
- C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
- common name:
- L-quinate
- inchi key:
- InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
- molecular weight:
- 191.16
- Synonym(s):
- (-)-quinic acid
- (-)-quinate
- (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.
