Difference between revisions of "QUINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3113 == * Synonym(s): == Reactions associated == * NADH-DEHYDROG-A-RXN ** pantograph-esiliculosus * NADHor_2m ** pantogr...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * common name: ** L-quinate...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_3113 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] ==
 +
* smiles:
 +
** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
 +
* common name:
 +
** L-quinate
 +
* inchi key:
 +
** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
 +
* molecular weight:
 +
** 191.16   
 
* Synonym(s):
 
* Synonym(s):
 +
** (-)-quinic acid
 +
** (-)-quinate
 +
** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NADH-DEHYDROG-A-RXN]]
+
* [[QUINATE-5-DEHYDROGENASE-RXN]]
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-7967]]
* [[NADHor_2m]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-6692]]
+
* [[PWY-3781]]
+
* [[PWY-5083]]
+
* [[PWY0-1335]]
+
* [[PWY0-1334]]
+
* [[PWY-4302]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|NADHor_2m}}
+
* CAS : 77-95-2
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1335|PWY0-1334|PWY-4302}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296]
 +
{{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}}
 +
{{#set: common name=L-quinate}}
 +
{{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}}
 +
{{#set: molecular weight=191.16    }}
 +
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}}
 +
{{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}}

Latest revision as of 21:13, 21 March 2018

Metabolite QUINATE

  • smiles:
    • C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
  • common name:
    • L-quinate
  • inchi key:
    • InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
  • molecular weight:
    • 191.16
  • Synonym(s):
    • (-)-quinic acid
    • (-)-quinate
    • (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.