Difference between revisions of "Tiso gene 12835"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * smiles: ** [CH](C(C(COP([O-])([O-])=O)O)O)=O * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_12835 == * right end position: ** 2273 * transcription direction: ** NEGATIVE * left end position: ** 89 * centisome position: ** 1.3281599...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12835 == |
− | * | + | * right end position: |
− | ** | + | ** 2273 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 89 |
− | * | + | * centisome position: |
− | ** | + | ** 1.3281599 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-9868]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-6087]] |
+ | * [[PWY-6193]] | ||
+ | * [[PWY-6089]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2273}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=89}} | |
− | + | {{#set: centisome position=1.3281599 }} | |
− | + | {{#set: reaction associated=CARBOXYMETHYLENEBUTENOLIDASE-RXN|RXN-9868}} | |
− | + | {{#set: pathway associated=PWY-6087|PWY-6193|PWY-6089}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:13, 21 March 2018
Gene Tiso_gene_12835
- right end position:
- 2273
- transcription direction:
- NEGATIVE
- left end position:
- 89
- centisome position:
- 1.3281599
- Synonym(s):
Reactions associated
- Reaction: CARBOXYMETHYLENEBUTENOLIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-9868
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation