Difference between revisions of "FORMYL-THF-GLU-N"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == * common name: ** an N10-formyl-tetrahydrofolate * Synony...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an N10-formyl-tetrahydrofolate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] |
− | * [[ | + | * [[FORMYLTHFGLUSYNTH-RXN]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[FORMATETHFLIG-RXN]] |
− | * [[ | + | * [[FORMYLTHFGLUSYNTH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[GART-RXN]] |
+ | * [[AICARTRANSFORM-RXN]] | ||
+ | * [[METHENYLTHFCYCLOHYDRO-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an N10-formyl-tetrahydrofolate}} | |
− | + | {{#set: consumed by=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN|FORMYLTHFGLUSYNTH-RXN}} | |
− | + | {{#set: produced by=FORMATETHFLIG-RXN|FORMYLTHFGLUSYNTH-RXN}} | |
− | + | {{#set: reversible reaction associated=GART-RXN|AICARTRANSFORM-RXN|METHENYLTHFCYCLOHYDRO-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite FORMYL-THF-GLU-N
- common name:
- an N10-formyl-tetrahydrofolate
- Synonym(s):