Difference between revisions of "RXN-13607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * smiles: ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F
+
 
* common name:
 
* common name:
−
** D-myo-inositol (3,4,5,6)-tetrakisphosphate
+
** exostosin_family_protein
−
* molecular weight:
+
* ec number:
−
** 492.013   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(3,4,5,6)P4
 
−
** Inositol 3,4,5,6-tetrakisphosphate
 
−
** 1D-myo-inositol 3,4,5,6-tetrakisphosphate
 
−
** I(3,4,5,6)P4
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.7.1.134-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-14601]][c] '''=>''' 1 [[CPD-14602]][c] '''+''' 1 [[UDP]][c]
−
* [[RXN-10955]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 UDP-α-D-glucuronate[c] '''+''' 1 mycophenolate[c] '''=>''' 1 mycophenolic acid O-acyl-glucuronide[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14140]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04520 C04520]
+
{{#set: common name=exostosin_family_protein}}
−
* CHEBI:
+
{{#set: ec number=EC-2.4.1.17}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57539 57539]
+
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
−
* METABOLIGHTS : MTBLC57539
+
{{#set: in pathway=}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201333 25201333]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* HMDB : HMDB03848
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F}}
+
−
{{#set: common name=D-myo-inositol (3,4,5,6)-tetrakisphosphate}}
+
−
{{#set: molecular weight=492.013    }}
+
−
{{#set: common name=Ins(3,4,5,6)P4|Inositol 3,4,5,6-tetrakisphosphate|1D-myo-inositol 3,4,5,6-tetrakisphosphate|I(3,4,5,6)P4}}
+
−
{{#set: consumed by=2.7.1.134-RXN}}
+
−
{{#set: produced by=RXN-10955}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-13607

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UDP-α-D-glucuronate[c] + 1 mycophenolate[c] => 1 mycophenolic acid O-acyl-glucuronide[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13607&oldid=47027"