Difference between revisions of "CPD-15900"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10543 == * left end position: ** 6659 * transcription direction: ** NEGATIVE * right end position: ** 8416 * centisome position: ** 78.7860...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 903.641 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-15013]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551544 72551544] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76527 76527] |
− | {{#set: reaction associated= | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
+ | {{#set: common name=2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J}} | ||
+ | {{#set: molecular weight=903.641 }} | ||
+ | {{#set: reversible reaction associated=RXN-15013}} |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-15900
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- common name:
- 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA
- inchi key:
- InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J
- molecular weight:
- 903.641
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.