Difference between revisions of "RXN-16118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16118 RXN-16118] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16118 RXN-16118] ==
* smiles:
+
* direction:
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
* molecular weight:
+
* ec number:
** 1118.034   
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17116]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17372]][c] '''+''' 1 [[CPD-17371]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17373]][c]
* [[RXN-17115]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 1-[18-hydroxyoleyl]-2-lyso-phosphatidate[c] '''+''' 1 18-hydroxylinoleoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6453]], stigma estolide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6453 PWY-6453]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193740 72193740]
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
* CHEBI:
+
{{#set: ec number=EC-2.3.1.51}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76367 76367]
+
{{#set: gene associated=Tiso_gene_13959}}
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=PWY-6453}}
{{#set: inchi key=InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
{{#set: molecular weight=1118.034    }}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: consumed by=RXN-17116}}
+
{{#set: produced by=RXN-17115}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-16118

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 1-[18-hydroxyoleyl]-2-lyso-phosphatidate[c] + 1 18-hydroxylinoleoyl-CoA[c] => 1 coenzyme A[c] + 1 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6453, stigma estolide biosynthesis: PWY-6453
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links