Difference between revisions of "E3-independent-Ubiquitin-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E3-independent-Ubiquitin-E2-L-cysteine E3-independent-Ubiquitin-E2-L-cysteine] == * common name...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E3-independent-Ubiquitin-E2-L-cysteine E3-independent-Ubiquitin-E2-L-cysteine] ==
−
* smiles:
+
−
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
−
* inchi key:
+
−
** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A19
+
** an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine
−
* molecular weight:
+
−
** 360.406   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GA19
+
** an [(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN1F-169]]
+
* [[RXN-16314]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN1F-168]]
+
* [[RXN-16313]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921]
+
{{#set: common name=an [(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine}}
−
* CHEBI:
+
{{#set: consumed by=RXN-16314}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587]
+
{{#set: produced by=RXN-16313}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034]
+
−
* HMDB : HMDB36896
+
−
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}}
+
−
{{#set: common name=gibberellin A19}}
+
−
{{#set: molecular weight=360.406    }}
+
−
{{#set: common name=GA19}}
+
−
{{#set: consumed by=RXN1F-169}}
+
−
{{#set: produced by=RXN1F-168}}
+

Latest revision as of 20:14, 21 March 2018

Metabolite E3-independent-Ubiquitin-E2-L-cysteine

  • common name:
    • an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an [(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [(E3-independent) E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an [(E3-independent) ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=E3-independent-Ubiquitin-E2-L-cysteine&oldid=47044"