Difference between revisions of "Tiso gene 10782"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_10782 == * Synonym(s): == Reactions associated == * Reaction: RXN-15556 ** Source: orthology-esiliculosus == Pathways associated =...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_10782 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-15556]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | == | + | == Pathways associated == |
| − | * [[ | + | * [[PWY-7511]] |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: reaction associated=RXN-15556}} |
| − | + | {{#set: pathway associated=PWY-7511}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_10782
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: orthology-esiliculosus
