Difference between revisions of "ITP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-148 RXN1F-148] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
| − | * | + | * common name: |
| − | ** | + | ** ITP |
| + | * inchi key: | ||
| + | ** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J | ||
| + | * molecular weight: | ||
| + | ** 504.137 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** inosine triphosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN0-5073]] | |
| − | + | * [[ITPP]] | |
| − | + | * [[ITUP]] | |
| − | + | * [[RXN0-6382]] | |
| − | + | * [[ITCY]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ATIDm]] | |
| − | * [[ | + | * [[ATID]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14120]] | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * CAS : 132-06-9 |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439] |
| − | {{#set: | + | * HMDB : HMDB00189 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402] |
| − | {{#set: | + | * BIGG : itp |
| + | {{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| + | {{#set: common name=ITP}} | ||
| + | {{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}} | ||
| + | {{#set: molecular weight=504.137 }} | ||
| + | {{#set: common name=inosine triphosphate}} | ||
| + | {{#set: consumed by=RXN0-5073|ITPP|ITUP|RXN0-6382|ITCY}} | ||
| + | {{#set: produced by=ATIDm|ATID}} | ||
| + | {{#set: reversible reaction associated=RXN-14120}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite ITP
- smiles:
- C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- common name:
- ITP
- inchi key:
- InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
- molecular weight:
- 504.137
- Synonym(s):
- inosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
