Difference between revisions of "Tiso gene 9833"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9833 == * right end position: ** 2960 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 2.212634100...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] ==
+
== Gene Tiso_gene_9833 ==
−
* smiles:
+
* right end position:
−
** C(CC(C(=O)[O-])[N+])ONC(N)=O
+
** 2960
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** O-ureidohomoserine
+
** 2
−
* molecular weight:
+
* centisome position:
−
** 177.16   
+
** 2.212634100e-2
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10]]
+
* Reaction: [[RXN-11839]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11840]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11841]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-11842]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2960}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12271
+
{{#set: left end position=2}}
−
{{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}}
+
{{#set: centisome position=2.212634100e-2}}
−
{{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}}
+
{{#set: reaction associated=RXN-11839|RXN-11840|RXN-11841|RXN-11842|TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: common name=O-ureidohomoserine}}
+
−
{{#set: molecular weight=177.16    }}
+
−
{{#set: consumed by=RXN-10}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_9833

  • right end position:
    • 2960
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2
  • centisome position:
    • 2.212634100e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9833&oldid=47065"