Difference between revisions of "CPD-19490"

Latest revision as of 20:14, 21 March 2018

"CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_1672 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] ==
-* left end position:
+* smiles:
-** 1684
+** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
-* transcription direction:
+* common name:
-** POSITIVE
+** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
-* right end position:
+* inchi key:
-** 9013
+** InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
-* centisome position:
+* molecular weight:
-** 7.5597057
+** 232.251
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ATPASE-RXN]]
+* [[RXN-18207]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
+* [[RXN-18206]]
 == External links  ==
-{{#set: left end position=1684}}
+{{#set: smiles=CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
-{{#set: transcription direction=POSITIVE}}
+{{#set: common name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
-{{#set: right end position=9013}}
+{{#set: inchi key=InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L}}
-{{#set: centisome position=7.5597057    }}
+{{#set: molecular weight=232.251    }}
-{{#set: reaction associated=ATPASE-RXN}}
+{{#set: consumed by=RXN-18207}}
+{{#set: reversible reaction associated=RXN-18206}}