Difference between revisions of "CPD1F-130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * inchi key: ** InChIKey=U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-130 CPD1F-130] == * smiles: ** CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-130 CPD1F-130] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2(=C(CC(CC(C)(C)2)O)C))C)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** zeaxanthin |
| + | * inchi key: | ||
| + | ** InChIKey=JKQXZKUSFCKOGQ-QAYBQHTQSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 568.881 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** β,β-carotene-3,3'-diol |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7978]] |
| − | * [[RXN- | + | * [[RXN-13193]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7985]] | ||
| + | * [[RXN-8026]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13185]] | ||
== External links == | == External links == | ||
| − | * LIPID_MAPS : | + | * LIPID_MAPS : LMPR01070261 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280899 5280899] |
| + | * HMDB : HMDB02789 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06098 C06098] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4444421.html 4444421] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27547 27547] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC27547 |
| − | + | {{#set: smiles=CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2(=C(CC(CC(C)(C)2)O)C))C)C}} | |
| − | {{#set: smiles= | + | {{#set: common name=zeaxanthin}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JKQXZKUSFCKOGQ-QAYBQHTQSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=568.881 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=β,β-carotene-3,3'-diol}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-7978|RXN-13193}} |
| − | {{#set: | + | {{#set: produced by=RXN-7985|RXN-8026}} |
| + | {{#set: reversible reaction associated=RXN-13185}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD1F-130
- smiles:
- CC(C=CC=C(C=CC1(C(C)(C)CC(CC=1C)O))C)=CC=CC=C(C=CC=C(C=CC2(=C(CC(CC(C)(C)2)O)C))C)C
- common name:
- zeaxanthin
- inchi key:
- InChIKey=JKQXZKUSFCKOGQ-QAYBQHTQSA-N
- molecular weight:
- 568.881
- Synonym(s):
- β,β-carotene-3,3'-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR01070261
- PUBCHEM:
- HMDB : HMDB02789
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC27547
